About N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine
N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine (PubChem CID 746494) has the molecular formula C14H26N2S
and a molecular weight of 254.44 g/mol. Its IUPAC name is N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine |
| PubChem CID | 746494 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine |
| SMILES | Cc1sc(C)c(CNC(C)C)c1CNC(C)C |
| InChI | InChI=1S/C14H26N2S/c1-9(2)15-7-13-11(5)17-12(6)14(13)8-16-10(3)4/h9-10,15-16H,7-8H2,1-6H3 |
| InChIKey | ZSFBCWPBDIIUQI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine?
The IUPAC name of N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine (CID 746494) is N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine.
What is the SMILES notation for N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine?
The canonical SMILES for N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine is Cc1sc(C)c(CNC(C)C)c1CNC(C)C.
What is the InChIKey of N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine?
The InChIKey is ZSFBCWPBDIIUQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2S/c1-9(2)15-7-13-11(5)17-12(6)14(13)8-16-10(3)4/h9-10,15-16H,7-8H2,1-6H3.
What are the key properties of N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine?
N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine has a molecular weight of 254.44 g/mol, XLogP of 3.36, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2,5-dimethyl-4-[(propan-2-ylamino)methyl]thiophen-3-yl]methyl]propan-2-amine is sourced from PubChem (CID 746494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).