C13H14N4OS3 — CID 746521
14,14-dimethyl-7-methylsulfanyl-13-oxa-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-5-thione (PubChem CID 746521) has the molecular formula C13H14N4OS3 and a molecular weight of 338.48 g/mol. Its IUPAC name is 14,14-dimethyl-7-methylsulfanyl-13-oxa-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-5-thione.
| Compound Name | 14,14-dimethyl-7-methylsulfanyl-13-oxa-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-5-thione |
|---|---|
| PubChem CID | 746521 |
| Molecular Formula | C13H14N4OS3 |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 14,14-dimethyl-7-methylsulfanyl-13-oxa-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-5-thione |
| SMILES | CSc1nc2sc3c(c2c2n[nH]c(=S)n12)CC(C)(C)OC3 |
| InChI | InChI=1S/C13H14N4OS3/c1-13(2)4-6-7(5-18-13)21-10-8(6)9-15-16-11(19)17(9)12(14-10)20-3/h4-5H2,1-3H3,(H,16,19) |
| InChIKey | WCAMZIJBSZBOFO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|