About 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one
2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one (PubChem CID 74659874) has the molecular formula C5H11N3O2
and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one |
| PubChem CID | 74659874 |
| Molecular Formula | C5H11N3O2 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one |
| SMILES | NC1NC(=O)CC(CO)N1 |
| InChI | InChI=1S/C5H11N3O2/c6-5-7-3(2-9)1-4(10)8-5/h3,5,7,9H,1-2,6H2,(H,8,10) |
| InChIKey | QIWNERJVOMAUMS-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one?
The IUPAC name of 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one (CID 74659874) is 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one.
What is the SMILES notation for 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one?
The canonical SMILES for 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one is NC1NC(=O)CC(CO)N1.
What is the InChIKey of 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one?
The InChIKey is QIWNERJVOMAUMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O2/c6-5-7-3(2-9)1-4(10)8-5/h3,5,7,9H,1-2,6H2,(H,8,10).
What are the key properties of 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one?
2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one has a molecular weight of 145.16 g/mol, XLogP of -2.30, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(hydroxymethyl)-1,3-diazinan-4-one is sourced from PubChem (CID 74659874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).