About 2-N,5-N-diphenylpyridine-2,5-dicarboxamide
2-N,5-N-diphenylpyridine-2,5-dicarboxamide (PubChem CID 746699) has the molecular formula C19H15N3O2
and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-N,5-N-diphenylpyridine-2,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,5-N-diphenylpyridine-2,5-dicarboxamide |
| PubChem CID | 746699 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-N,5-N-diphenylpyridine-2,5-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(C(=O)Nc2ccccc2)nc1 |
| InChI | InChI=1S/C19H15N3O2/c23-18(21-15-7-3-1-4-8-15)14-11-12-17(20-13-14)19(24)22-16-9-5-2-6-10-16/h1-13H,(H,21,23)(H,22,24) |
| InChIKey | OLFSCPKAHMFATL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N,5-N-diphenylpyridine-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,5-N-diphenylpyridine-2,5-dicarboxamide?
The IUPAC name of 2-N,5-N-diphenylpyridine-2,5-dicarboxamide (CID 746699) is 2-N,5-N-diphenylpyridine-2,5-dicarboxamide.
What is the SMILES notation for 2-N,5-N-diphenylpyridine-2,5-dicarboxamide?
The canonical SMILES for 2-N,5-N-diphenylpyridine-2,5-dicarboxamide is O=C(Nc1ccccc1)c1ccc(C(=O)Nc2ccccc2)nc1.
What is the InChIKey of 2-N,5-N-diphenylpyridine-2,5-dicarboxamide?
The InChIKey is OLFSCPKAHMFATL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O2/c23-18(21-15-7-3-1-4-8-15)14-11-12-17(20-13-14)19(24)22-16-9-5-2-6-10-16/h1-13H,(H,21,23)(H,22,24).
What are the key properties of 2-N,5-N-diphenylpyridine-2,5-dicarboxamide?
2-N,5-N-diphenylpyridine-2,5-dicarboxamide has a molecular weight of 317.35 g/mol, XLogP of 3.59, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,5-N-diphenylpyridine-2,5-dicarboxamide is sourced from PubChem (CID 746699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).