C9H8BrN5 — CID 746710
6-(4-bromophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 746710) has the molecular formula C9H8BrN5 and a molecular weight of 266.10 g/mol. Its IUPAC name is 6-(4-bromophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(4-bromophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 746710 |
| Molecular Formula | C9H8BrN5 |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | 6-(4-bromophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C9H8BrN5/c10-6-3-1-5(2-4-6)7-13-8(11)15-9(12)14-7/h1-4H,(H4,11,12,13,14,15) |
| InChIKey | IFTSWIQNKJOSLN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |