C17H12F5NO3S — CID 7467349
(2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylpropanamide (PubChem CID 7467349) has the molecular formula C17H12F5NO3S and a molecular weight of 405.34 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7467349 |
| Molecular Formula | C17H12F5NO3S |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1c(F)c(F)c(F)c(F)c1F)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H12F5NO3S/c1-7(27-16-14(21)12(19)11(18)13(20)15(16)22)17(24)23-5-8-2-3-9-10(4-8)26-6-25-9/h2-4,7H,5-6H2,1H3,(H,23,24)/t7-/m0/s1 |
| InChIKey | KVFPTUOSEPSIIU-ZETCQYMHSA-N |
| XLogP | 3.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|