C9H6F5NOS — CID 7467364
(2R)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylpropanamide (PubChem CID 7467364) has the molecular formula C9H6F5NOS and a molecular weight of 271.21 g/mol. Its IUPAC name is (2R)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylpropanamide.
| Compound Name | (2R)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7467364 |
| Molecular Formula | C9H6F5NOS |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | (2R)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylpropanamide |
| SMILES | C[C@@H](Sc1c(F)c(F)c(F)c(F)c1F)C(N)=O |
| InChI | InChI=1S/C9H6F5NOS/c1-2(9(15)16)17-8-6(13)4(11)3(10)5(12)7(8)14/h2H,1H3,(H2,15,16)/t2-/m1/s1 |
| InChIKey | TUVPJNPHDSHKKM-UWTATZPHSA-N |
| XLogP | 2.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|