C15H13F5N2O3S — CID 7467374
ethyl (4R)-4-methyl-2-oxo-6-[(2,3,4,5,6-pentafluorophenyl)sulfanylmethyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 7467374) has the molecular formula C15H13F5N2O3S and a molecular weight of 396.34 g/mol. Its IUPAC name is ethyl (4R)-4-methyl-2-oxo-6-[(2,3,4,5,6-pentafluorophenyl)sulfanylmethyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-4-methyl-2-oxo-6-[(2,3,4,5,6-pentafluorophenyl)sulfanylmethyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7467374 |
| Molecular Formula | C15H13F5N2O3S |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | ethyl (4R)-4-methyl-2-oxo-6-[(2,3,4,5,6-pentafluorophenyl)sulfanylmethyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CSc2c(F)c(F)c(F)c(F)c2F)NC(=O)N[C@@H]1C |
| InChI | InChI=1S/C15H13F5N2O3S/c1-3-25-14(23)7-5(2)21-15(24)22-6(7)4-26-13-11(19)9(17)8(16)10(18)12(13)20/h5H,3-4H2,1-2H3,(H2,21,22,24)/t5-/m1/s1 |
| InChIKey | GMMNTEIDFQXMPK-RXMQYKEDSA-N |
| XLogP | 2.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|