About dipropan-2-yl pyridine-2,6-dicarboxylate
dipropan-2-yl pyridine-2,6-dicarboxylate (PubChem CID 746767) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is dipropan-2-yl pyridine-2,6-dicarboxylate.
Molecular Properties
| Compound Name | dipropan-2-yl pyridine-2,6-dicarboxylate |
| PubChem CID | 746767 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | dipropan-2-yl pyridine-2,6-dicarboxylate |
| SMILES | CC(C)OC(=O)c1cccc(C(=O)OC(C)C)n1 |
| InChI | InChI=1S/C13H17NO4/c1-8(2)17-12(15)10-6-5-7-11(14-10)13(16)18-9(3)4/h5-9H,1-4H3 |
| InChIKey | CPWRDMOUBGOUGY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dipropan-2-yl pyridine-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl pyridine-2,6-dicarboxylate?
The IUPAC name of dipropan-2-yl pyridine-2,6-dicarboxylate (CID 746767) is dipropan-2-yl pyridine-2,6-dicarboxylate.
What is the SMILES notation for dipropan-2-yl pyridine-2,6-dicarboxylate?
The canonical SMILES for dipropan-2-yl pyridine-2,6-dicarboxylate is CC(C)OC(=O)c1cccc(C(=O)OC(C)C)n1.
What is the InChIKey of dipropan-2-yl pyridine-2,6-dicarboxylate?
The InChIKey is CPWRDMOUBGOUGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-8(2)17-12(15)10-6-5-7-11(14-10)13(16)18-9(3)4/h5-9H,1-4H3.
What are the key properties of dipropan-2-yl pyridine-2,6-dicarboxylate?
dipropan-2-yl pyridine-2,6-dicarboxylate has a molecular weight of 251.28 g/mol, XLogP of 2.21, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl pyridine-2,6-dicarboxylate is sourced from PubChem (CID 746767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).