C26H31N5O4 — CID 74686368
benzyl 2-[1,7-dimethyl-9-(3-methylphenyl)-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetate (PubChem CID 74686368) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is benzyl 2-[1,7-dimethyl-9-(3-methylphenyl)-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetate.
| Compound Name | benzyl 2-[1,7-dimethyl-9-(3-methylphenyl)-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetate |
|---|---|
| PubChem CID | 74686368 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | benzyl 2-[1,7-dimethyl-9-(3-methylphenyl)-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetate |
| SMILES | Cc1cccc(N2CC(C)CN3C4C(=O)N(CC(=O)OCc5ccccc5)C(=O)N(C)C4NC23)c1 |
| InChI | InChI=1S/C26H31N5O4/c1-17-8-7-11-20(12-17)29-13-18(2)14-30-22-23(27-25(29)30)28(3)26(34)31(24(22)33)15-21(32)35-16-19-9-5-4-6-10-19/h4-12,18,22-23,25,27H,13-16H2,1-3H3 |
| InChIKey | JGCJKFLHVJWJAA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |