C19H22N2O4S — CID 7468662
N-(2-methoxy-5-nitrophenyl)-2-(2,3,5,6-tetramethylphenyl)sulfanylacetamide (PubChem CID 7468662) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2-(2,3,5,6-tetramethylphenyl)sulfanylacetamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2-(2,3,5,6-tetramethylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 7468662 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2-(2,3,5,6-tetramethylphenyl)sulfanylacetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CSc1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C19H22N2O4S/c1-11-8-12(2)14(4)19(13(11)3)26-10-18(22)20-16-9-15(21(23)24)6-7-17(16)25-5/h6-9H,10H2,1-5H3,(H,20,22) |
| InChIKey | JTZBLAMYPLDENN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|