C19H21N3O4 — CID 74687117
prop-2-enyl 7-methyl-5-(3-methylphenyl)-2,4-dioxo-4a,5,8,8a-tetrahydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 74687117) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is prop-2-enyl 7-methyl-5-(3-methylphenyl)-2,4-dioxo-4a,5,8,8a-tetrahydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 7-methyl-5-(3-methylphenyl)-2,4-dioxo-4a,5,8,8a-tetrahydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 74687117 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | prop-2-enyl 7-methyl-5-(3-methylphenyl)-2,4-dioxo-4a,5,8,8a-tetrahydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)NC2NC(=O)NC(=O)C2C1c1cccc(C)c1 |
| InChI | InChI=1S/C19H21N3O4/c1-4-8-26-18(24)13-11(3)20-16-15(17(23)22-19(25)21-16)14(13)12-7-5-6-10(2)9-12/h4-7,9,14-16,20H,1,8H2,2-3H3,(H2,21,22,23,25) |
| InChIKey | XFRWULHSTHFBNB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|