About 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine
6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine (PubChem CID 74688445) has the molecular formula C15H10FN3OS
and a molecular weight of 299.33 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine.
Molecular Properties
| Compound Name | 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine |
| PubChem CID | 74688445 |
| Molecular Formula | C15H10FN3OS |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine |
| SMILES | [H]/N=C1\N=NC(c2ccc(F)cc2)=CSC1=Cc1ccco1 |
| InChI | InChI=1S/C15H10FN3OS/c16-11-5-3-10(4-6-11)13-9-21-14(15(17)19-18-13)8-12-2-1-7-20-12/h1-9,17H/b14-8?,17-15- |
| InChIKey | WISXKKCRGJGHEE-GVCMXFLESA-N |
| XLogP | 4.93 |
| TPSA | 61.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine?
The IUPAC name of 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine (CID 74688445) is 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine.
What is the SMILES notation for 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine?
The canonical SMILES for 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine is [H]/N=C1\N=NC(c2ccc(F)cc2)=CSC1=Cc1ccco1.
What is the InChIKey of 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine?
The InChIKey is WISXKKCRGJGHEE-GVCMXFLESA-N. The full InChI is InChI=1S/C15H10FN3OS/c16-11-5-3-10(4-6-11)13-9-21-14(15(17)19-18-13)8-12-2-1-7-20-12/h1-9,17H/b14-8?,17-15-.
What are the key properties of 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine?
6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine has a molecular weight of 299.33 g/mol, XLogP of 4.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorophenyl)-2-(furan-2-ylmethylidene)-1,4,5-thiadiazepin-3-imine is sourced from PubChem (CID 74688445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).