C22H20ClNO4 — CID 7468906
2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 7468906) has the molecular formula C22H20ClNO4 and a molecular weight of 397.86 g/mol. Its IUPAC name is 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 7468906 |
| Molecular Formula | C22H20ClNO4 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)N[C@H]3CCCc4ccccc43)c(Cl)cc12 |
| InChI | InChI=1S/C22H20ClNO4/c1-13-9-22(26)28-19-11-20(17(23)10-16(13)19)27-12-21(25)24-18-8-4-6-14-5-2-3-7-15(14)18/h2-3,5,7,9-11,18H,4,6,8,12H2,1H3,(H,24,25)/t18-/m0/s1 |
| InChIKey | PLUUVAFDNFEJCX-SFHVURJKSA-N |
| XLogP | 4.33 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|