About (4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one
(4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one (PubChem CID 746933) has the molecular formula C5H10N2O3
and a molecular weight of 146.15 g/mol. Its IUPAC name is (4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one.
Analyze (4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one?
The IUPAC name of (4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one (CID 746933) is (4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one.
What is the SMILES notation for (4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one?
The canonical SMILES for (4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one is CN1C(=O)N(C)[C@@H](O)[C@H]1O.
What is the InChIKey of (4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one?
The InChIKey is LGJMYGMNWHYGCB-ZXZARUISSA-N. The full InChI is InChI=1S/C5H10N2O3/c1-6-3(8)4(9)7(2)5(6)10/h3-4,8-9H,1-2H3/t3-,4+.
What are the key properties of (4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one?
(4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one has a molecular weight of 146.15 g/mol, XLogP of -1.38, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-4,5-dihydroxy-1,3-dimethylimidazolidin-2-one is sourced from PubChem (CID 746933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).