About (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate
(4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 7469399) has the molecular formula C15H15NO4S
and a molecular weight of 305.36 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 7469399 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)c2sc(C)nc2C)cc1 |
| InChI | InChI=1S/C15H15NO4S/c1-9-13(21-10(2)16-9)15(18)20-8-11-4-6-12(7-5-11)14(17)19-3/h4-7H,8H2,1-3H3 |
| InChIKey | KJUIDRJPUCGTLO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The IUPAC name of (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate (CID 7469399) is (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate is COC(=O)c1ccc(COC(=O)c2sc(C)nc2C)cc1.
What is the InChIKey of (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The InChIKey is KJUIDRJPUCGTLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO4S/c1-9-13(21-10(2)16-9)15(18)20-8-11-4-6-12(7-5-11)14(17)19-3/h4-7H,8H2,1-3H3.
What are the key properties of (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate?
(4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate has a molecular weight of 305.36 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxycarbonylphenyl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 7469399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).