About (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one
(6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one (PubChem CID 746944) has the molecular formula C12H13N3O3
and a molecular weight of 247.25 g/mol. Its IUPAC name is (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one |
| PubChem CID | 746944 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one |
| SMILES | CC1=C([N+](=O)[O-])[C@@H](c2ccccc2)NC(=O)N1C |
| InChI | InChI=1S/C12H13N3O3/c1-8-11(15(17)18)10(13-12(16)14(8)2)9-6-4-3-5-7-9/h3-7,10H,1-2H3,(H,13,16)/t10-/m1/s1 |
| InChIKey | WWSRVSLYAAVSEL-SNVBAGLBSA-N |
| XLogP | 1.89 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one?
The IUPAC name of (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one (CID 746944) is (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one.
What is the SMILES notation for (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one?
The canonical SMILES for (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one is CC1=C([N+](=O)[O-])[C@@H](c2ccccc2)NC(=O)N1C.
What is the InChIKey of (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one?
The InChIKey is WWSRVSLYAAVSEL-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H13N3O3/c1-8-11(15(17)18)10(13-12(16)14(8)2)9-6-4-3-5-7-9/h3-7,10H,1-2H3,(H,13,16)/t10-/m1/s1.
What are the key properties of (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one?
(6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one has a molecular weight of 247.25 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-3,4-dimethyl-5-nitro-6-phenyl-1,6-dihydropyrimidin-2-one is sourced from PubChem (CID 746944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).