C16H28N2O6S — CID 74699972
[3-(propylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate (PubChem CID 74699972) has the molecular formula C16H28N2O6S and a molecular weight of 376.48 g/mol. Its IUPAC name is [3-(propylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate.
| Compound Name | [3-(propylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 74699972 |
| Molecular Formula | C16H28N2O6S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [3-(propylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate |
| SMILES | CCCS(=O)(=O)NC1COC2C(OC(=O)NC3CCCCC3)COC12 |
| InChI | InChI=1S/C16H28N2O6S/c1-2-8-25(20,21)18-12-9-22-15-13(10-23-14(12)15)24-16(19)17-11-6-4-3-5-7-11/h11-15,18H,2-10H2,1H3,(H,17,19) |
| InChIKey | VMASFSZICBLZND-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |