C18H20N4O3S2 — CID 7470325
(5Z)-3-[(2S)-butan-2-yl]-5-[[2-(2-hydroxyethylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 7470325) has the molecular formula C18H20N4O3S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is (5Z)-3-[(2S)-butan-2-yl]-5-[[2-(2-hydroxyethylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[(2S)-butan-2-yl]-5-[[2-(2-hydroxyethylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7470325 |
| Molecular Formula | C18H20N4O3S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (5Z)-3-[(2S)-butan-2-yl]-5-[[2-(2-hydroxyethylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC[C@H](C)N1C(=O)/C(=C/c2c(NCCO)nc3ccccn3c2=O)SC1=S |
| InChI | InChI=1S/C18H20N4O3S2/c1-3-11(2)22-17(25)13(27-18(22)26)10-12-15(19-7-9-23)20-14-6-4-5-8-21(14)16(12)24/h4-6,8,10-11,19,23H,3,7,9H2,1-2H3/b13-10-/t11-/m0/s1 |
| InChIKey | FDSYTDPHUWZKFT-KBICQTFXSA-N |
| XLogP | 2.10 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|