C17H20BrN5O4 — CID 74707060
2-[9-(4-bromophenyl)-1-methyl-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetic acid (PubChem CID 74707060) has the molecular formula C17H20BrN5O4 and a molecular weight of 438.28 g/mol. Its IUPAC name is 2-[9-(4-bromophenyl)-1-methyl-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetic acid.
| Compound Name | 2-[9-(4-bromophenyl)-1-methyl-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 74707060 |
| Molecular Formula | C17H20BrN5O4 |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 2-[9-(4-bromophenyl)-1-methyl-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetic acid |
| SMILES | CN1C(=O)N(CC(=O)O)C(=O)C2C1NC1N(c3ccc(Br)cc3)CCCN21 |
| InChI | InChI=1S/C17H20BrN5O4/c1-20-14-13(15(26)23(17(20)27)9-12(24)25)22-8-2-7-21(16(22)19-14)11-5-3-10(18)4-6-11/h3-6,13-14,16,19H,2,7-9H2,1H3,(H,24,25) |
| InChIKey | KVAFGOSYPDLXSL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |