C34H32ClN5O2 — CID 74712810
4-[1-[(4-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]-2,7,7-trimethyl-5-oxo-N-pyridin-2-yl-3,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 74712810) has the molecular formula C34H32ClN5O2 and a molecular weight of 578.12 g/mol. Its IUPAC name is 4-[1-[(4-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]-2,7,7-trimethyl-5-oxo-N-pyridin-2-yl-3,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 4-[1-[(4-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]-2,7,7-trimethyl-5-oxo-N-pyridin-2-yl-3,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 74712810 |
| Molecular Formula | C34H32ClN5O2 |
| Molecular Weight | 578.12 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 4-[1-[(4-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]-2,7,7-trimethyl-5-oxo-N-pyridin-2-yl-3,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CC1=NC2=C(C(=O)CC(C)(C)C2)C(c2cn(Cc3ccc(Cl)cc3)nc2-c2ccccc2)C1C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C34H32ClN5O2/c1-21-29(33(42)38-28-11-7-8-16-36-28)30(31-26(37-21)17-34(2,3)18-27(31)41)25-20-40(19-22-12-14-24(35)15-13-22)39-32(25)23-9-5-4-6-10-23/h4-16,20,29-30H,17-19H2,1-3H3,(H,36,38,42) |
| InChIKey | NOOSQYBRJYSDBT-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.12 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |