C19H12Cl2N2O4 — CID 7472306
(3aR,6aS)-5-(4-acetylphenyl)-3-(2,4-dichlorophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 7472306) has the molecular formula C19H12Cl2N2O4 and a molecular weight of 403.22 g/mol. Its IUPAC name is (3aR,6aS)-5-(4-acetylphenyl)-3-(2,4-dichlorophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3aR,6aS)-5-(4-acetylphenyl)-3-(2,4-dichlorophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 7472306 |
| Molecular Formula | C19H12Cl2N2O4 |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | (3aR,6aS)-5-(4-acetylphenyl)-3-(2,4-dichlorophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)[C@@H]3C(c4ccc(Cl)cc4Cl)=NO[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C19H12Cl2N2O4/c1-9(24)10-2-5-12(6-3-10)23-18(25)15-16(22-27-17(15)19(23)26)13-7-4-11(20)8-14(13)21/h2-8,15,17H,1H3/t15-,17+/m1/s1 |
| InChIKey | BFTUPFFENDEOTF-WBVHZDCISA-N |
| XLogP | 3.49 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|