C15H15F3N2O2 — CID 7472763
(4aS,8aR)-4-oxido-3-[3-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydroquinoxalin-1-ium 1-oxide (PubChem CID 7472763) has the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is (4aS,8aR)-4-oxido-3-[3-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydroquinoxalin-1-ium 1-oxide.
| Compound Name | (4aS,8aR)-4-oxido-3-[3-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydroquinoxalin-1-ium 1-oxide |
|---|---|
| PubChem CID | 7472763 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (4aS,8aR)-4-oxido-3-[3-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydroquinoxalin-1-ium 1-oxide |
| SMILES | O=[N+]1C=C(c2cccc(C(F)(F)F)c2)N([O-])[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C15H15F3N2O2/c16-15(17,18)11-5-3-4-10(8-11)14-9-19(21)12-6-1-2-7-13(12)20(14)22/h3-5,8-9,12-13H,1-2,6-7H2/t12-,13+/m1/s1 |
| InChIKey | UCHDVCMPBYBHCV-OLZOCXBDSA-N |
| XLogP | 3.91 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|