About (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate
(2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate (PubChem CID 7472903) has the molecular formula C19H19NO4
and a molecular weight of 325.36 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate.
Molecular Properties
| Compound Name | (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate |
| PubChem CID | 7472903 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCC(=O)NC(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H19NO4/c1-12-9-13(2)17(14(3)10-12)19(23)24-11-16(21)20-18(22)15-7-5-4-6-8-15/h4-10H,11H2,1-3H3,(H,20,21,22) |
| InChIKey | FFKSCZFCDIRXGT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate?
The IUPAC name of (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate (CID 7472903) is (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate.
What is the SMILES notation for (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate?
The canonical SMILES for (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate is Cc1cc(C)c(C(=O)OCC(=O)NC(=O)c2ccccc2)c(C)c1.
What is the InChIKey of (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate?
The InChIKey is FFKSCZFCDIRXGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO4/c1-12-9-13(2)17(14(3)10-12)19(23)24-11-16(21)20-18(22)15-7-5-4-6-8-15/h4-10H,11H2,1-3H3,(H,20,21,22).
What are the key properties of (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate?
(2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate has a molecular weight of 325.36 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzamido-2-oxoethyl) 2,4,6-trimethylbenzoate is sourced from PubChem (CID 7472903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).