About ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate
ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate (PubChem CID 74730845) has the molecular formula C18H27N6O5+
and a molecular weight of 407.45 g/mol. Its IUPAC name is ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate |
| PubChem CID | 74730845 |
| Molecular Formula | C18H27N6O5+ |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC2=[N+](CC(C)=O)C3C(=O)N(C)C(=O)N(C)C3=N2)CC1 |
| InChI | InChI=1S/C18H27N6O5/c1-5-29-18(28)23-8-6-22(7-9-23)11-13-19-15-14(24(13)10-12(2)25)16(26)21(4)17(27)20(15)3/h14H,5-11H2,1-4H3/q+1 |
| InChIKey | GWLJSBUMFGCHPU-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 105.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate (CID 74730845) is ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(CC2=[N+](CC(C)=O)C3C(=O)N(C)C(=O)N(C)C3=N2)CC1.
What is the InChIKey of ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate?
The InChIKey is GWLJSBUMFGCHPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N6O5/c1-5-29-18(28)23-8-6-22(7-9-23)11-13-19-15-14(24(13)10-12(2)25)16(26)21(4)17(27)20(15)3/h14H,5-11H2,1-4H3/q+1.
What are the key properties of ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate?
ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate has a molecular weight of 407.45 g/mol, XLogP of -0.94, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[1,3-dimethyl-2,6-dioxo-7-(2-oxopropyl)-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate is sourced from PubChem (CID 74730845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).