C24H26FN5S2 — CID 74736322
1-(4-fluorophenyl)-3-[[5-(2-methyl-6-thiophen-2-ylpyrimidin-4-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea (PubChem CID 74736322) has the molecular formula C24H26FN5S2 and a molecular weight of 467.64 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[[5-(2-methyl-6-thiophen-2-ylpyrimidin-4-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[[5-(2-methyl-6-thiophen-2-ylpyrimidin-4-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 74736322 |
| Molecular Formula | C24H26FN5S2 |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[[5-(2-methyl-6-thiophen-2-ylpyrimidin-4-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
| SMILES | Cc1nc(-c2cccs2)cc(C2CN3CCC2CC3CNC(=S)Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C24H26FN5S2/c1-15-27-21(12-22(28-15)23-3-2-10-32-23)20-14-30-9-8-16(20)11-19(30)13-26-24(31)29-18-6-4-17(25)5-7-18/h2-7,10,12,16,19-20H,8-9,11,13-14H2,1H3,(H2,26,29,31) |
| InChIKey | LAIPLNWFWXGNCG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|