C21H29N5O — CID 74736340
1-(3-cyanophenyl)-3-[[5-(pyrrolidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]urea (PubChem CID 74736340) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[[5-(pyrrolidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[[5-(pyrrolidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 74736340 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[[5-(pyrrolidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]urea |
| SMILES | N#Cc1cccc(NC(=O)NCC2CC3CCN2CC3CN2CCCC2)c1 |
| InChI | InChI=1S/C21H29N5O/c22-12-16-4-3-5-19(10-16)24-21(27)23-13-20-11-17-6-9-26(20)15-18(17)14-25-7-1-2-8-25/h3-5,10,17-18,20H,1-2,6-9,11,13-15H2,(H2,23,24,27) |
| InChIKey | QESACZJGXOUZSM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |