C19H23ClN3O+ — CID 7473635
3-chloro-4-methyl-N-[2-(4-methylpiperazin-4-ium-1-yl)phenyl]benzamide (PubChem CID 7473635) has the molecular formula C19H23ClN3O+ and a molecular weight of 344.87 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-[2-(4-methylpiperazin-4-ium-1-yl)phenyl]benzamide.
| Compound Name | 3-chloro-4-methyl-N-[2-(4-methylpiperazin-4-ium-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 7473635 |
| Molecular Formula | C19H23ClN3O+ |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-chloro-4-methyl-N-[2-(4-methylpiperazin-4-ium-1-yl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2N2CC[NH+](C)CC2)cc1Cl |
| InChI | InChI=1S/C19H22ClN3O/c1-14-7-8-15(13-16(14)20)19(24)21-17-5-3-4-6-18(17)23-11-9-22(2)10-12-23/h3-8,13H,9-12H2,1-2H3,(H,21,24)/p+1 |
| InChIKey | SSYCFHSRIWDMSK-UHFFFAOYSA-O |
| XLogP | 2.24 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |