C23H24F3N3O4S — CID 74736872
N-benzyl-4,5-dihydroxy-N-methyl-2-[4-(trifluoromethoxy)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 74736872) has the molecular formula C23H24F3N3O4S and a molecular weight of 495.52 g/mol. Its IUPAC name is N-benzyl-4,5-dihydroxy-N-methyl-2-[4-(trifluoromethoxy)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | N-benzyl-4,5-dihydroxy-N-methyl-2-[4-(trifluoromethoxy)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 74736872 |
| Molecular Formula | C23H24F3N3O4S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | N-benzyl-4,5-dihydroxy-N-methyl-2-[4-(trifluoromethoxy)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C1CC(O)C(O)C2N=C(Nc3ccc(OC(F)(F)F)cc3)SC12 |
| InChI | InChI=1S/C23H24F3N3O4S/c1-29(12-13-5-3-2-4-6-13)21(32)16-11-17(30)19(31)18-20(16)34-22(28-18)27-14-7-9-15(10-8-14)33-23(24,25)26/h2-10,16-20,30-31H,11-12H2,1H3,(H,27,28) |
| InChIKey | FCKJWZCLGAOMGN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |