C14H11ClN4O5 — CID 7474321
ethyl (3aR,6aR)-5-(4-chlorophenyl)-1-nitroso-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 7474321) has the molecular formula C14H11ClN4O5 and a molecular weight of 350.72 g/mol. Its IUPAC name is ethyl (3aR,6aR)-5-(4-chlorophenyl)-1-nitroso-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | ethyl (3aR,6aR)-5-(4-chlorophenyl)-1-nitroso-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 7474321 |
| Molecular Formula | C14H11ClN4O5 |
| Molecular Weight | 350.72 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | ethyl (3aR,6aR)-5-(4-chlorophenyl)-1-nitroso-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(N=O)[C@H]2C(=O)N(c3ccc(Cl)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C14H11ClN4O5/c1-2-24-14(22)10-9-11(19(16-10)17-23)13(21)18(12(9)20)8-5-3-7(15)4-6-8/h3-6,9,11H,2H2,1H3/t9-,11+/m0/s1 |
| InChIKey | OUSSJXBSQFYHGD-GXSJLCMTSA-N |
| XLogP | 1.11 |
| TPSA | 108.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.72 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|