About [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate
[3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate (PubChem CID 7475237) has the molecular formula C13H11F3N2O5S
and a molecular weight of 364.30 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate.
Molecular Properties
| Compound Name | [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate |
| PubChem CID | 7475237 |
| Molecular Formula | C13H11F3N2O5S |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate |
| SMILES | Cn1cc(S(=O)(=O)Oc2cccc(C(F)(F)F)c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C13H11F3N2O5S/c1-17-7-10(11(19)18(2)12(17)20)24(21,22)23-9-5-3-4-8(6-9)13(14,15)16/h3-7H,1-2H3 |
| InChIKey | IOPPILHSDUBTPM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate?
The IUPAC name of [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate (CID 7475237) is [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate.
What is the SMILES notation for [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate?
The canonical SMILES for [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate is Cn1cc(S(=O)(=O)Oc2cccc(C(F)(F)F)c2)c(=O)n(C)c1=O.
What is the InChIKey of [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate?
The InChIKey is IOPPILHSDUBTPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O5S/c1-17-7-10(11(19)18(2)12(17)20)24(21,22)23-9-5-3-4-8(6-9)13(14,15)16/h3-7H,1-2H3.
What are the key properties of [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate?
[3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate has a molecular weight of 364.30 g/mol, XLogP of 0.87, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(trifluoromethyl)phenyl] 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate is sourced from PubChem (CID 7475237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).