C14H13F3N2O5S — CID 7475316
[3-(trifluoromethyl)phenyl] 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate (PubChem CID 7475316) has the molecular formula C14H13F3N2O5S and a molecular weight of 378.33 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl] 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate.
| Compound Name | [3-(trifluoromethyl)phenyl] 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate |
|---|---|
| PubChem CID | 7475316 |
| Molecular Formula | C14H13F3N2O5S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [3-(trifluoromethyl)phenyl] 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate |
| SMILES | Cc1c(S(=O)(=O)Oc2cccc(C(F)(F)F)c2)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C14H13F3N2O5S/c1-8-11(12(20)19(3)13(21)18(8)2)25(22,23)24-10-6-4-5-9(7-10)14(15,16)17/h4-7H,1-3H3 |
| InChIKey | CCQCPGFRRPYWPS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|