C16H20N2O5S — CID 7475329
(2,4,6-trimethylphenyl) 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate (PubChem CID 7475329) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate.
| Compound Name | (2,4,6-trimethylphenyl) 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate |
|---|---|
| PubChem CID | 7475329 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (2,4,6-trimethylphenyl) 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonate |
| SMILES | Cc1cc(C)c(OS(=O)(=O)c2c(C)n(C)c(=O)n(C)c2=O)c(C)c1 |
| InChI | InChI=1S/C16H20N2O5S/c1-9-7-10(2)13(11(3)8-9)23-24(21,22)14-12(4)17(5)16(20)18(6)15(14)19/h7-8H,1-6H3 |
| InChIKey | KPAYTBYQCCOVSU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|