About N,N-dibenzyl-2,2-difluoroacetamide
N,N-dibenzyl-2,2-difluoroacetamide (PubChem CID 747536) has the molecular formula C16H15F2NO
and a molecular weight of 275.30 g/mol. Its IUPAC name is N,N-dibenzyl-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N,N-dibenzyl-2,2-difluoroacetamide |
| PubChem CID | 747536 |
| Molecular Formula | C16H15F2NO |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N,N-dibenzyl-2,2-difluoroacetamide |
| SMILES | O=C(C(F)F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C16H15F2NO/c17-15(18)16(20)19(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| InChIKey | JIYOYYWECYVAPM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dibenzyl-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibenzyl-2,2-difluoroacetamide?
The IUPAC name of N,N-dibenzyl-2,2-difluoroacetamide (CID 747536) is N,N-dibenzyl-2,2-difluoroacetamide.
What is the SMILES notation for N,N-dibenzyl-2,2-difluoroacetamide?
The canonical SMILES for N,N-dibenzyl-2,2-difluoroacetamide is O=C(C(F)F)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of N,N-dibenzyl-2,2-difluoroacetamide?
The InChIKey is JIYOYYWECYVAPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2NO/c17-15(18)16(20)19(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,15H,11-12H2.
What are the key properties of N,N-dibenzyl-2,2-difluoroacetamide?
N,N-dibenzyl-2,2-difluoroacetamide has a molecular weight of 275.30 g/mol, XLogP of 3.48, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibenzyl-2,2-difluoroacetamide is sourced from PubChem (CID 747536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).