C16H11NO4 — CID 747553
4-[(1,3-dioxoisoindol-2-yl)methyl]benzoic acid (PubChem CID 747553) has the molecular formula C16H11NO4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoic acid.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 747553 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C16H11NO4/c18-14-12-3-1-2-4-13(12)15(19)17(14)9-10-5-7-11(8-6-10)16(20)21/h1-8H,9H2,(H,20,21) |
| InChIKey | NIHMCLGGARGAHJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|