C18H17N5O4 — CID 7475808
6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,4,7-trimethylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 7475808) has the molecular formula C18H17N5O4 and a molecular weight of 367.37 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,4,7-trimethylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,4,7-trimethylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 7475808 |
| Molecular Formula | C18H17N5O4 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,4,7-trimethylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1cn2c3c(=O)n(C)c(=O)n(C)c3nc2n1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H17N5O4/c1-10-9-22-14-15(20(2)18(25)21(3)16(14)24)19-17(22)23(10)11-4-5-12-13(8-11)27-7-6-26-12/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | AJKBZMWCAVUZEF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |