C20H17F3N6 — CID 74762859
(7R,8S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-amine (PubChem CID 74762859) has the molecular formula C20H17F3N6 and a molecular weight of 398.39 g/mol. Its IUPAC name is (7R,8S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-amine.
| Compound Name | (7R,8S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-amine |
|---|---|
| PubChem CID | 74762859 |
| Molecular Formula | C20H17F3N6 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (7R,8S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-8-amine |
| SMILES | Cc1nc(-c2ccn3c4c(nc3c2)C[C@H](c2cc(F)c(F)cc2F)[C@@H](N)C4)n[nH]1 |
| InChI | InChI=1S/C20H17F3N6/c1-9-25-20(28-27-9)10-2-3-29-18-8-16(24)12(6-17(18)26-19(29)4-10)11-5-14(22)15(23)7-13(11)21/h2-5,7,12,16H,6,8,24H2,1H3,(H,25,27,28)/t12-,16+/m1/s1 |
| InChIKey | SURCKAGHZNYZKR-WBMJQRKESA-N |
| XLogP | 3.05 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|