About N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide
N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide (PubChem CID 74763247) has the molecular formula C19H14N6O3S
and a molecular weight of 406.43 g/mol. Its IUPAC name is N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide |
| PubChem CID | 74763247 |
| Molecular Formula | C19H14N6O3S |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide |
| SMILES | C#Cc1cnc2ccc(-c3cnc(OC)c(NS(=O)(=O)c4cccnc4)c3)nn12 |
| InChI | InChI=1S/C19H14N6O3S/c1-3-14-11-21-18-7-6-16(23-25(14)18)13-9-17(19(28-2)22-10-13)24-29(26,27)15-5-4-8-20-12-15/h1,4-12,24H,2H3 |
| InChIKey | NPOMVXDRHLTCFZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide?
The IUPAC name of N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide (CID 74763247) is N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide.
What is the SMILES notation for N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide?
The canonical SMILES for N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide is C#Cc1cnc2ccc(-c3cnc(OC)c(NS(=O)(=O)c4cccnc4)c3)nn12.
What is the InChIKey of N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide?
The InChIKey is NPOMVXDRHLTCFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N6O3S/c1-3-14-11-21-18-7-6-16(23-25(14)18)13-9-17(19(28-2)22-10-13)24-29(26,27)15-5-4-8-20-12-15/h1,4-12,24H,2H3.
What are the key properties of N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide?
N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide has a molecular weight of 406.43 g/mol, XLogP of 1.98, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-2-methoxy-3-pyridinyl]pyridine-3-sulfonamide is sourced from PubChem (CID 74763247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).