C20H30BN5O7 — CID 74763445
[(1R)-3-methyl-1-[[1-[2-[(2,3,4-trimethoxybenzoyl)amino]ethyl]triazole-4-carbonyl]amino]butyl]boronic acid (PubChem CID 74763445) has the molecular formula C20H30BN5O7 and a molecular weight of 463.30 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[1-[2-[(2,3,4-trimethoxybenzoyl)amino]ethyl]triazole-4-carbonyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[1-[2-[(2,3,4-trimethoxybenzoyl)amino]ethyl]triazole-4-carbonyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 74763445 |
| Molecular Formula | C20H30BN5O7 |
| Molecular Weight | 463.30 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | [(1R)-3-methyl-1-[[1-[2-[(2,3,4-trimethoxybenzoyl)amino]ethyl]triazole-4-carbonyl]amino]butyl]boronic acid |
| SMILES | COc1ccc(C(=O)NCCn2cc(C(=O)N[C@@H](CC(C)C)B(O)O)nn2)c(OC)c1OC |
| InChI | InChI=1S/C20H30BN5O7/c1-12(2)10-16(21(29)30)23-20(28)14-11-26(25-24-14)9-8-22-19(27)13-6-7-15(31-3)18(33-5)17(13)32-4/h6-7,11-12,16,29-30H,8-10H2,1-5H3,(H,22,27)(H,23,28)/t16-/m0/s1 |
| InChIKey | SPBARNLOSXEWID-INIZCTEOSA-N |
| XLogP | -0.11 |
| TPSA | 157.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|