C13H13N5OS — CID 74763951
1-(2,3-dimethylindazol-6-yl)-3-(1,3-thiazol-4-yl)urea (PubChem CID 74763951) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is 1-(2,3-dimethylindazol-6-yl)-3-(1,3-thiazol-4-yl)urea.
| Compound Name | 1-(2,3-dimethylindazol-6-yl)-3-(1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 74763951 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-(2,3-dimethylindazol-6-yl)-3-(1,3-thiazol-4-yl)urea |
| SMILES | Cc1c2ccc(NC(=O)Nc3cscn3)cc2nn1C |
| InChI | InChI=1S/C13H13N5OS/c1-8-10-4-3-9(5-11(10)17-18(8)2)15-13(19)16-12-6-20-7-14-12/h3-7H,1-2H3,(H2,15,16,19) |
| InChIKey | DKJSNBQLIRNTBE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |