About 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride
4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride (PubChem CID 74764031) has the molecular formula C11H19ClN2
and a molecular weight of 214.74 g/mol. Its IUPAC name is 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride.
Molecular Properties
| Compound Name | 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride |
| PubChem CID | 74764031 |
| Molecular Formula | C11H19ClN2 |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride |
| SMILES | CCN(CC)c1ccc(N)c(C)c1.[Cl-].[H+] |
| InChI | InChI=1S/C11H18N2.ClH/c1-4-13(5-2)10-6-7-11(12)9(3)8-10;/h6-8H,4-5,12H2,1-3H3;1H |
| InChIKey | MPLZNPZPPXERDA-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride?
The IUPAC name of 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride (CID 74764031) is 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride.
What is the SMILES notation for 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride?
The canonical SMILES for 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride is CCN(CC)c1ccc(N)c(C)c1.[Cl-].[H+].
What is the InChIKey of 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride?
The InChIKey is MPLZNPZPPXERDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2.ClH/c1-4-13(5-2)10-6-7-11(12)9(3)8-10;/h6-8H,4-5,12H2,1-3H3;1H.
What are the key properties of 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride?
4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride has a molecular weight of 214.74 g/mol, XLogP of -0.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-diethyl-2-methylbenzene-1,4-diamine;hydron;chloride is sourced from PubChem (CID 74764031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).