About 2,9-dimethyl-1,10-phenanthroline;hydron;chloride
2,9-dimethyl-1,10-phenanthroline;hydron;chloride (PubChem CID 74764058) has the molecular formula C14H13ClN2
and a molecular weight of 244.72 g/mol. Its IUPAC name is 2,9-dimethyl-1,10-phenanthroline;hydron;chloride.
Molecular Properties
| Compound Name | 2,9-dimethyl-1,10-phenanthroline;hydron;chloride |
| PubChem CID | 74764058 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2,9-dimethyl-1,10-phenanthroline;hydron;chloride |
| SMILES | Cc1ccc2ccc3ccc(C)nc3c2n1.[Cl-].[H+] |
| InChI | InChI=1S/C14H12N2.ClH/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;/h3-8H,1-2H3;1H |
| InChIKey | QUGBNSJLQDNNPK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,9-dimethyl-1,10-phenanthroline;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-dimethyl-1,10-phenanthroline;hydron;chloride?
The IUPAC name of 2,9-dimethyl-1,10-phenanthroline;hydron;chloride (CID 74764058) is 2,9-dimethyl-1,10-phenanthroline;hydron;chloride.
What is the SMILES notation for 2,9-dimethyl-1,10-phenanthroline;hydron;chloride?
The canonical SMILES for 2,9-dimethyl-1,10-phenanthroline;hydron;chloride is Cc1ccc2ccc3ccc(C)nc3c2n1.[Cl-].[H+].
What is the InChIKey of 2,9-dimethyl-1,10-phenanthroline;hydron;chloride?
The InChIKey is QUGBNSJLQDNNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2.ClH/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;/h3-8H,1-2H3;1H.
What are the key properties of 2,9-dimethyl-1,10-phenanthroline;hydron;chloride?
2,9-dimethyl-1,10-phenanthroline;hydron;chloride has a molecular weight of 244.72 g/mol, XLogP of 0.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-dimethyl-1,10-phenanthroline;hydron;chloride is sourced from PubChem (CID 74764058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).