C16H30O8Si — CID 74765278
[4-acetyloxy-1-[tert-butyl(dimethyl)silyl]oxy-2,5-dihydroxy-6-oxohexan-3-yl] acetate (PubChem CID 74765278) has the molecular formula C16H30O8Si and a molecular weight of 378.49 g/mol. Its IUPAC name is [4-acetyloxy-1-[tert-butyl(dimethyl)silyl]oxy-2,5-dihydroxy-6-oxohexan-3-yl] acetate.
| Compound Name | [4-acetyloxy-1-[tert-butyl(dimethyl)silyl]oxy-2,5-dihydroxy-6-oxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 74765278 |
| Molecular Formula | C16H30O8Si |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [4-acetyloxy-1-[tert-butyl(dimethyl)silyl]oxy-2,5-dihydroxy-6-oxohexan-3-yl] acetate |
| SMILES | CC(=O)OC(C(O)C=O)C(OC(C)=O)C(O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O8Si/c1-10(18)23-14(12(20)8-17)15(24-11(2)19)13(21)9-22-25(6,7)16(3,4)5/h8,12-15,20-21H,9H2,1-7H3 |
| InChIKey | DGPMSALVNCCUAW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|