About hexyl 5-amino-4-oxopentanoate;hydron;chloride
hexyl 5-amino-4-oxopentanoate;hydron;chloride (PubChem CID 74765297) has the molecular formula C11H22ClNO3
and a molecular weight of 251.75 g/mol. Its IUPAC name is hexyl 5-amino-4-oxopentanoate;hydron;chloride.
Molecular Properties
| Compound Name | hexyl 5-amino-4-oxopentanoate;hydron;chloride |
| PubChem CID | 74765297 |
| Molecular Formula | C11H22ClNO3 |
| Molecular Weight | 251.75 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | hexyl 5-amino-4-oxopentanoate;hydron;chloride |
| SMILES | CCCCCCOC(=O)CCC(=O)CN.[Cl-].[H+] |
| InChI | InChI=1S/C11H21NO3.ClH/c1-2-3-4-5-8-15-11(14)7-6-10(13)9-12;/h2-9,12H2,1H3;1H |
| InChIKey | LZYXPFZBAZTOCH-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.75 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl 5-amino-4-oxopentanoate;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 5-amino-4-oxopentanoate;hydron;chloride?
The IUPAC name of hexyl 5-amino-4-oxopentanoate;hydron;chloride (CID 74765297) is hexyl 5-amino-4-oxopentanoate;hydron;chloride.
What is the SMILES notation for hexyl 5-amino-4-oxopentanoate;hydron;chloride?
The canonical SMILES for hexyl 5-amino-4-oxopentanoate;hydron;chloride is CCCCCCOC(=O)CCC(=O)CN.[Cl-].[H+].
What is the InChIKey of hexyl 5-amino-4-oxopentanoate;hydron;chloride?
The InChIKey is LZYXPFZBAZTOCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3.ClH/c1-2-3-4-5-8-15-11(14)7-6-10(13)9-12;/h2-9,12H2,1H3;1H.
What are the key properties of hexyl 5-amino-4-oxopentanoate;hydron;chloride?
hexyl 5-amino-4-oxopentanoate;hydron;chloride has a molecular weight of 251.75 g/mol, XLogP of -1.47, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 5-amino-4-oxopentanoate;hydron;chloride is sourced from PubChem (CID 74765297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).