C18H30BN3O5S — CID 74765677
[(1R)-1-[[(2S)-6-amino-2-[[(2R)-2-hydroxy-2-phenylacetyl]amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid (PubChem CID 74765677) has the molecular formula C18H30BN3O5S and a molecular weight of 411.33 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-6-amino-2-[[(2R)-2-hydroxy-2-phenylacetyl]amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-6-amino-2-[[(2R)-2-hydroxy-2-phenylacetyl]amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
|---|---|
| PubChem CID | 74765677 |
| Molecular Formula | C18H30BN3O5S |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [(1R)-1-[[(2S)-6-amino-2-[[(2R)-2-hydroxy-2-phenylacetyl]amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](O)c1ccccc1)B(O)O |
| InChI | InChI=1S/C18H30BN3O5S/c1-28-12-10-15(19(26)27)22-17(24)14(9-5-6-11-20)21-18(25)16(23)13-7-3-2-4-8-13/h2-4,7-8,14-16,23,26-27H,5-6,9-12,20H2,1H3,(H,21,25)(H,22,24)/t14-,15-,16+/m0/s1 |
| InChIKey | KDKFGRFLVNPWRP-HRCADAONSA-N |
| XLogP | -0.42 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|