C19H31BN4O4S — CID 74765696
[(1R)-1-[[(2S)-6-amino-2-[[(2S)-2,3-dihydro-1H-indole-2-carbonyl]amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid (PubChem CID 74765696) has the molecular formula C19H31BN4O4S and a molecular weight of 422.36 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-6-amino-2-[[(2S)-2,3-dihydro-1H-indole-2-carbonyl]amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-6-amino-2-[[(2S)-2,3-dihydro-1H-indole-2-carbonyl]amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
|---|---|
| PubChem CID | 74765696 |
| Molecular Formula | C19H31BN4O4S |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [(1R)-1-[[(2S)-6-amino-2-[[(2S)-2,3-dihydro-1H-indole-2-carbonyl]amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H]1Cc2ccccc2N1)B(O)O |
| InChI | InChI=1S/C19H31BN4O4S/c1-29-11-9-17(20(27)28)24-18(25)15(8-4-5-10-21)23-19(26)16-12-13-6-2-3-7-14(13)22-16/h2-3,6-7,15-17,22,27-28H,4-5,8-12,21H2,1H3,(H,23,26)(H,24,25)/t15-,16-,17-/m0/s1 |
| InChIKey | IHFCFBJEKKPPNV-ULQDDVLXSA-N |
| XLogP | -0.11 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|