About 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline
2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline (PubChem CID 74765948) has the molecular formula C32H22N6
and a molecular weight of 490.57 g/mol. Its IUPAC name is 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline.
Molecular Properties
| Compound Name | 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline |
| PubChem CID | 74765948 |
| Molecular Formula | C32H22N6 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline |
| SMILES | c1cnc2c(c1)ccc1cc(-c3ccncc3)[nH]c12.c1cnc2c(c1)ccc1cc(-c3ccncc3)[nH]c12 |
| InChI | InChI=1S/2C16H11N3/c2*1-2-12-3-4-13-10-14(11-5-8-17-9-6-11)19-16(13)15(12)18-7-1/h2*1-10,19H |
| InChIKey | RGYLUPIESBULTQ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline?
The IUPAC name of 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline (CID 74765948) is 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline.
What is the SMILES notation for 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline?
The canonical SMILES for 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline is c1cnc2c(c1)ccc1cc(-c3ccncc3)[nH]c12.c1cnc2c(c1)ccc1cc(-c3ccncc3)[nH]c12.
What is the InChIKey of 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline?
The InChIKey is RGYLUPIESBULTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H11N3/c2*1-2-12-3-4-13-10-14(11-5-8-17-9-6-11)19-16(13)15(12)18-7-1/h2*1-10,19H.
What are the key properties of 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline?
2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline has a molecular weight of 490.57 g/mol, XLogP of 7.56, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-4-yl-1H-pyrrolo[3,2-h]quinoline is sourced from PubChem (CID 74765948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).