C21H36O5 — CID 74765961
cis-ditert-butyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]cyclopentane-1,1-dicarboxylate (PubChem CID 74765961) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is cis-ditert-butyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-ditert-butyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 74765961 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | cis-ditert-butyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]cyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)C[C@@H]1OC(C)(C)C |
| InChI | InChI=1S/C21H36O5/c1-11-14-12-21(16(22)25-19(5,6)7,17(23)26-20(8,9)10)13-15(14)24-18(2,3)4/h11,14-15H,1,12-13H2,2-10H3/t14-,15-/m0/s1 |
| InChIKey | AXNONQQBQLWAKY-GJZGRUSLSA-N |
| XLogP | 4.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|