C31H42O5Si — CID 74765966
trans-diphenyl (3S,4R)-4-ethenyl-3-methyl-3-tri(propan-2-yl)silyloxycyclopentane-1,1-dicarboxylate (PubChem CID 74765966) has the molecular formula C31H42O5Si and a molecular weight of 522.76 g/mol. Its IUPAC name is trans-diphenyl (3S,4R)-4-ethenyl-3-methyl-3-tri(propan-2-yl)silyloxycyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diphenyl (3S,4R)-4-ethenyl-3-methyl-3-tri(propan-2-yl)silyloxycyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 74765966 |
| Molecular Formula | C31H42O5Si |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | trans-diphenyl (3S,4R)-4-ethenyl-3-methyl-3-tri(propan-2-yl)silyloxycyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)Oc2ccccc2)(C(=O)Oc2ccccc2)C[C@]1(C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H42O5Si/c1-9-25-20-31(28(32)34-26-16-12-10-13-17-26,29(33)35-27-18-14-11-15-19-27)21-30(25,8)36-37(22(2)3,23(4)5)24(6)7/h9-19,22-25H,1,20-21H2,2-8H3/t25-,30-/m0/s1 |
| InChIKey | CUVZQGHYCCSRNB-QCDSWUKFSA-N |
| XLogP | 7.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|