C15H24O5 — CID 74765977
cis-dimethyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]cyclopentane-1,1-dicarboxylate (PubChem CID 74765977) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is cis-dimethyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 74765977 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | cis-dimethyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]cyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OC)(C(=O)OC)C[C@@H]1OC(C)(C)C |
| InChI | InChI=1S/C15H24O5/c1-7-10-8-15(12(16)18-5,13(17)19-6)9-11(10)20-14(2,3)4/h7,10-11H,1,8-9H2,2-6H3/t10-,11-/m0/s1 |
| InChIKey | PHBOSONNSIPAOQ-QWRGUYRKSA-N |
| XLogP | 2.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|